C19H31N3O4 — CID 155189839
(4S,5R)-4-amino-5-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]hexanamide (PubChem CID 155189839) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is (4S,5R)-4-amino-5-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]hexanamide.
| Compound Name | (4S,5R)-4-amino-5-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]hexanamide |
|---|---|
| PubChem CID | 155189839 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | (4S,5R)-4-amino-5-[[4-[4-(2-amino-2-oxoethoxy)butyl]phenyl]methoxy]hexanamide |
| SMILES | C[C@@H](OCc1ccc(CCCCOCC(N)=O)cc1)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C19H31N3O4/c1-14(17(20)9-10-18(21)23)26-12-16-7-5-15(6-8-16)4-2-3-11-25-13-19(22)24/h5-8,14,17H,2-4,9-13,20H2,1H3,(H2,21,23)(H2,22,24)/t14-,17+/m1/s1 |
| InChIKey | CQKHLGDDIXFEGD-PBHICJAKSA-N |
| XLogP | 1.01 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|