C24H38N2O6 — CID 155189663
6-[2-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hexanoic acid (PubChem CID 155189663) has the molecular formula C24H38N2O6 and a molecular weight of 450.58 g/mol. Its IUPAC name is 6-[2-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hexanoic acid.
| Compound Name | 6-[2-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 155189663 |
| Molecular Formula | C24H38N2O6 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 6-[2-[[(2R,3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexan-2-yl]oxymethyl]phenyl]hexanoic acid |
| SMILES | C[C@@H](OCc1ccccc1CCCCCC(=O)O)[C@H](CCC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N2O6/c1-17(20(14-15-21(25)27)26-23(30)32-24(2,3)4)31-16-19-12-9-8-11-18(19)10-6-5-7-13-22(28)29/h8-9,11-12,17,20H,5-7,10,13-16H2,1-4H3,(H2,25,27)(H,26,30)(H,28,29)/t17-,20+/m1/s1 |
| InChIKey | LDMUKYNHJMFHHI-XLIONFOSSA-N |
| XLogP | 3.94 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|