C24H25N7O2 — CID 170206974
1-[4-[N-amino-2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-6-(4-methylanilino)-3-pyridinyl]ethanone (PubChem CID 170206974) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[4-[N-amino-2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-6-(4-methylanilino)-3-pyridinyl]ethanone.
| Compound Name | 1-[4-[N-amino-2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-6-(4-methylanilino)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 170206974 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[4-[N-amino-2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-6-(4-methylanilino)-3-pyridinyl]ethanone |
| SMILES | COc1c(-c2ncn(C)n2)cccc1N(N)c1cc(Nc2ccc(C)cc2)ncc1C(C)=O |
| InChI | InChI=1S/C24H25N7O2/c1-15-8-10-17(11-9-15)28-22-12-21(19(13-26-22)16(2)32)31(25)20-7-5-6-18(23(20)33-4)24-27-14-30(3)29-24/h5-14H,25H2,1-4H3,(H,26,28) |
| InChIKey | PFCMYFLYWCWCRD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|