C17H18N6O4S — CID 17020754
1-ethyl-N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4-nitropyrazole-3-carboxamide (PubChem CID 17020754) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is 1-ethyl-N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17020754 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1-ethyl-N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-4-nitropyrazole-3-carboxamide |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)Nn2c(C)nc3sc4c(c3c2=O)CCCC4)n1 |
| InChI | InChI=1S/C17H18N6O4S/c1-3-21-8-11(23(26)27)14(19-21)15(24)20-22-9(2)18-16-13(17(22)25)10-6-4-5-7-12(10)28-16/h8H,3-7H2,1-2H3,(H,20,24) |
| InChIKey | DZGPOBZIOPQVGV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|