C20H18N6O5S — CID 17020774
N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 17020774) has the molecular formula C20H18N6O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17020774 |
| Molecular Formula | C20H18N6O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-(2-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1nc2sc3c(c2c(=O)n1NC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1)CCCC3 |
| InChI | InChI=1S/C20H18N6O5S/c1-11-22-19-17(14-4-2-3-5-16(14)32-19)20(28)25(11)23-18(27)15-7-6-13(31-15)10-24-9-12(8-21-24)26(29)30/h6-9H,2-5,10H2,1H3,(H,23,27) |
| InChIKey | TVFDXNRJQMYNPO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|