C15H22N4O3 — CID 170207736
(3-hydroxypiperidin-1-yl)-[6-(oxan-4-ylamino)pyrimidin-4-yl]methanone (PubChem CID 170207736) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-[6-(oxan-4-ylamino)pyrimidin-4-yl]methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-[6-(oxan-4-ylamino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 170207736 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-[6-(oxan-4-ylamino)pyrimidin-4-yl]methanone |
| SMILES | O=C(c1cc(NC2CCOCC2)ncn1)N1CCCC(O)C1 |
| InChI | InChI=1S/C15H22N4O3/c20-12-2-1-5-19(9-12)15(21)13-8-14(17-10-16-13)18-11-3-6-22-7-4-11/h8,10-12,20H,1-7,9H2,(H,16,17,18) |
| InChIKey | UTJMZVQCKYYLND-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |