C15H22N4O4 — CID 175334926
(4-methylmorpholin-2-yl) 6-(oxan-4-ylamino)pyrimidine-4-carboxylate (PubChem CID 175334926) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is (4-methylmorpholin-2-yl) 6-(oxan-4-ylamino)pyrimidine-4-carboxylate.
| Compound Name | (4-methylmorpholin-2-yl) 6-(oxan-4-ylamino)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 175334926 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (4-methylmorpholin-2-yl) 6-(oxan-4-ylamino)pyrimidine-4-carboxylate |
| SMILES | CN1CCOC(OC(=O)c2cc(NC3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C15H22N4O4/c1-19-4-7-22-14(9-19)23-15(20)12-8-13(17-10-16-12)18-11-2-5-21-6-3-11/h8,10-11,14H,2-7,9H2,1H3,(H,16,17,18) |
| InChIKey | ZIFSIXPOEUIHAB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |