C16H27N3 — CID 170210088
N,3,3-triethyl-5-pyrazin-2-ylhex-5-en-1-amine (PubChem CID 170210088) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N,3,3-triethyl-5-pyrazin-2-ylhex-5-en-1-amine.
| Compound Name | N,3,3-triethyl-5-pyrazin-2-ylhex-5-en-1-amine |
|---|---|
| PubChem CID | 170210088 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N,3,3-triethyl-5-pyrazin-2-ylhex-5-en-1-amine |
| SMILES | C=C(CC(CC)(CC)CCNCC)c1cnccn1 |
| InChI | InChI=1S/C16H27N3/c1-5-16(6-2,8-9-17-7-3)12-14(4)15-13-18-10-11-19-15/h10-11,13,17H,4-9,12H2,1-3H3 |
| InChIKey | XURMNVXESIIQNJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|