C14H24N2S — CID 143067711
ethane;2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]pyrazine;propane (PubChem CID 143067711) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is ethane;2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]pyrazine;propane.
| Compound Name | ethane;2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]pyrazine;propane |
|---|---|
| PubChem CID | 143067711 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethane;2-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]pyrazine;propane |
| SMILES | C=C/C=C(\SC)c1cnccn1.CC.CCC |
| InChI | InChI=1S/C9H10N2S.C3H8.C2H6/c1-3-4-9(12-2)8-7-10-5-6-11-8;1-3-2;1-2/h3-7H,1H2,2H3;3H2,1-2H3;1-2H3/b9-4-;; |
| InChIKey | XERAHFMKEPVNRA-FPAIPBCFSA-N |
| XLogP | 4.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|