C11H10N4OS — CID 4643023
S-(4,6-dimethylpyrimidin-2-yl) pyrazine-2-carbothioate (PubChem CID 4643023) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is S-(4,6-dimethylpyrimidin-2-yl) pyrazine-2-carbothioate.
| Compound Name | S-(4,6-dimethylpyrimidin-2-yl) pyrazine-2-carbothioate |
|---|---|
| PubChem CID | 4643023 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | S-(4,6-dimethylpyrimidin-2-yl) pyrazine-2-carbothioate |
| SMILES | Cc1cc(C)nc(SC(=O)c2cnccn2)n1 |
| InChI | InChI=1S/C11H10N4OS/c1-7-5-8(2)15-11(14-7)17-10(16)9-6-12-3-4-13-9/h3-6H,1-2H3 |
| InChIKey | IJFHIXBQWLVJID-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|