C17H17N7O3S — CID 17021337
4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 17021337) has the molecular formula C17H17N7O3S and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 17021337 |
| Molecular Formula | C17H17N7O3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-[(3-methoxy-4-nitropyrazol-1-yl)methyl]-13-methyl-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | COc1nn(Cc2nc3c4c5c(sc4ncn3n2)CC(C)CC5)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N7O3S/c1-9-3-4-10-12(5-9)28-17-14(10)15-19-13(20-23(15)8-18-17)7-22-6-11(24(25)26)16(21-22)27-2/h6,8-9H,3-5,7H2,1-2H3 |
| InChIKey | XWMSLSAHIVYLTO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 113.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|