C26H26F3N5O3 — CID 170214489
N-propyl-4-[(3Z,5E)-5-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]hepta-1,3,5-trien-2-yl]oxypyrrolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 170214489) has the molecular formula C26H26F3N5O3 and a molecular weight of 513.52 g/mol. Its IUPAC name is N-propyl-4-[(3Z,5E)-5-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]hepta-1,3,5-trien-2-yl]oxypyrrolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-propyl-4-[(3Z,5E)-5-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]hepta-1,3,5-trien-2-yl]oxypyrrolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 170214489 |
| Molecular Formula | C26H26F3N5O3 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-propyl-4-[(3Z,5E)-5-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]hepta-1,3,5-trien-2-yl]oxypyrrolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | C=C(/C=C\C(=C/C)NC(=O)Cc1ccc(C(F)(F)F)cc1)Oc1ncnc2c1ccn2C(=O)NCCC |
| InChI | InChI=1S/C26H26F3N5O3/c1-4-13-30-25(36)34-14-12-21-23(34)31-16-32-24(21)37-17(3)6-11-20(5-2)33-22(35)15-18-7-9-19(10-8-18)26(27,28)29/h5-12,14,16H,3-4,13,15H2,1-2H3,(H,30,36)(H,33,35)/b11-6-,20-5+ |
| InChIKey | WXLRRAHXXWOMID-OHIOGSDRSA-N |
| XLogP | 5.13 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|