C33H40O8 — CID 170214795
[(3R,3aS,6R,6aS)-6-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]oxy-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-(4-butoxyphenyl)prop-2-enoate (PubChem CID 170214795) has the molecular formula C33H40O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is [(3R,3aS,6R,6aS)-6-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]oxy-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-(4-butoxyphenyl)prop-2-enoate.
| Compound Name | [(3R,3aS,6R,6aS)-6-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]oxy-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-(4-butoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 170214795 |
| Molecular Formula | C33H40O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [(3R,3aS,6R,6aS)-6-[(E)-3-(4-butoxyphenyl)prop-2-enoyl]oxy-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] (E)-3-(4-butoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)O[C@@H]2CO[C@@]3(C)[C@H](OC(=O)/C=C/c4ccc(OCCCC)cc4)CO[C@@H]23)cc1 |
| InChI | InChI=1S/C33H40O8/c1-4-6-20-36-26-14-8-24(9-15-26)12-18-30(34)40-28-22-39-33(3)29(23-38-32(28)33)41-31(35)19-13-25-10-16-27(17-11-25)37-21-7-5-2/h8-19,28-29,32H,4-7,20-23H2,1-3H3/b18-12+,19-13+/t28-,29-,32+,33+/m1/s1 |
| InChIKey | CDHPSNJCJRZIQK-UWAAMBKZSA-N |
| XLogP | 5.78 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|