C15H19BrN4OS2 — CID 17021487
2-[[5-(4-bromo-5-ethylthiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 17021487) has the molecular formula C15H19BrN4OS2 and a molecular weight of 415.38 g/mol. Its IUPAC name is 2-[[5-(4-bromo-5-ethylthiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[5-(4-bromo-5-ethylthiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 17021487 |
| Molecular Formula | C15H19BrN4OS2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-[[5-(4-bromo-5-ethylthiophen-2-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(-c2cc(Br)c(CC)s2)n1CC |
| InChI | InChI=1S/C15H19BrN4OS2/c1-4-7-17-13(21)9-22-15-19-18-14(20(15)6-3)12-8-10(16)11(5-2)23-12/h4,8H,1,5-7,9H2,2-3H3,(H,17,21) |
| InChIKey | DNNQCYFCYCIRCO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|