About [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate
[2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate (PubChem CID 170223279) has the molecular formula C20H37NO5
and a molecular weight of 371.52 g/mol. Its IUPAC name is [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate.
Molecular Properties
| Compound Name | [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate |
| PubChem CID | 170223279 |
| Molecular Formula | C20H37NO5 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate |
| SMILES | CCCC[C@H](C)CC(C)(C)OC(=O)COC(=O)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C20H37NO5/c1-7-8-9-16(2)14-19(3,4)26-17(22)15-25-18(23)20(5,6)21-10-12-24-13-11-21/h16H,7-15H2,1-6H3/t16-/m0/s1 |
| InChIKey | TYIIDFVBYWCJPX-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate?
The IUPAC name of [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate (CID 170223279) is [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate.
What is the SMILES notation for [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate?
The canonical SMILES for [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate is CCCC[C@H](C)CC(C)(C)OC(=O)COC(=O)C(C)(C)N1CCOCC1.
What is the InChIKey of [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate?
The InChIKey is TYIIDFVBYWCJPX-INIZCTEOSA-N. The full InChI is InChI=1S/C20H37NO5/c1-7-8-9-16(2)14-19(3,4)26-17(22)15-25-18(23)20(5,6)21-10-12-24-13-11-21/h16H,7-15H2,1-6H3/t16-/m0/s1.
What are the key properties of [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate?
[2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate has a molecular weight of 371.52 g/mol, XLogP of 3.18, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4S)-2,4-dimethyloctan-2-yl]oxy-2-oxoethyl] 2-methyl-2-morpholin-4-ylpropanoate is sourced from PubChem (CID 170223279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).