C14H27NO2 — CID 79045428
2,5-dimethyl-2-morpholin-4-yloctan-3-one (PubChem CID 79045428) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2,5-dimethyl-2-morpholin-4-yloctan-3-one.
| Compound Name | 2,5-dimethyl-2-morpholin-4-yloctan-3-one |
|---|---|
| PubChem CID | 79045428 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2,5-dimethyl-2-morpholin-4-yloctan-3-one |
| SMILES | CCCC(C)CC(=O)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C14H27NO2/c1-5-6-12(2)11-13(16)14(3,4)15-7-9-17-10-8-15/h12H,5-11H2,1-4H3 |
| InChIKey | WGNPKSPPIKBKQX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |