C17H18N4O2S — CID 170224474
7-(2-aminophenyl)-5-[(3R)-3-methylmorpholin-4-yl]-[1,2]thiazolo[4,5-b]pyridin-3-one (PubChem CID 170224474) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 7-(2-aminophenyl)-5-[(3R)-3-methylmorpholin-4-yl]-[1,2]thiazolo[4,5-b]pyridin-3-one.
| Compound Name | 7-(2-aminophenyl)-5-[(3R)-3-methylmorpholin-4-yl]-[1,2]thiazolo[4,5-b]pyridin-3-one |
|---|---|
| PubChem CID | 170224474 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 7-(2-aminophenyl)-5-[(3R)-3-methylmorpholin-4-yl]-[1,2]thiazolo[4,5-b]pyridin-3-one |
| SMILES | C[C@@H]1COCCN1c1cc(-c2ccccc2N)c2s[nH]c(=O)c2n1 |
| InChI | InChI=1S/C17H18N4O2S/c1-10-9-23-7-6-21(10)14-8-12(11-4-2-3-5-13(11)18)16-15(19-14)17(22)20-24-16/h2-5,8,10H,6-7,9,18H2,1H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | XIKPBKKFDHYGBF-SNVBAGLBSA-N |
| XLogP | 2.46 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|