C18H12O2 — CID 170226949
1-naphtho[2,1-b][1]benzofuran-9-ylethanone (PubChem CID 170226949) has the molecular formula C18H12O2 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-naphtho[2,1-b][1]benzofuran-9-ylethanone.
| Compound Name | 1-naphtho[2,1-b][1]benzofuran-9-ylethanone |
|---|---|
| PubChem CID | 170226949 |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-naphtho[2,1-b][1]benzofuran-9-ylethanone |
| SMILES | CC(=O)c1ccc2c(c1)oc1ccc3ccccc3c12 |
| InChI | InChI=1S/C18H12O2/c1-11(19)13-6-8-15-17(10-13)20-16-9-7-12-4-2-3-5-14(12)18(15)16/h2-10H,1H3 |
| InChIKey | QCSJYJWTERRRRT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |