C12H28N2OS — CID 170230249
N,N'-dimethyl-N-[2-(1-methylsulfanylethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 170230249) has the molecular formula C12H28N2OS and a molecular weight of 248.44 g/mol. Its IUPAC name is N,N'-dimethyl-N-[2-(1-methylsulfanylethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N-[2-(1-methylsulfanylethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 170230249 |
| Molecular Formula | C12H28N2OS |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N,N'-dimethyl-N-[2-(1-methylsulfanylethoxy)ethyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CSC(C)OCCN(C)CCN(C)C(C)C |
| InChI | InChI=1S/C12H28N2OS/c1-11(2)14(5)8-7-13(4)9-10-15-12(3)16-6/h11-12H,7-10H2,1-6H3 |
| InChIKey | VBEQPUKNUDGSDD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|