C15H18N2O2 — CID 170232453
4-[3-(pyridin-2-ylamino)propyl]cyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 170232453) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-[3-(pyridin-2-ylamino)propyl]cyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 4-[3-(pyridin-2-ylamino)propyl]cyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 170232453 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-[3-(pyridin-2-ylamino)propyl]cyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC=C(CCCNc2ccccn2)CC1 |
| InChI | InChI=1S/C15H18N2O2/c18-15(19)13-8-6-12(7-9-13)4-3-11-17-14-5-1-2-10-16-14/h1-2,5-6,8,10H,3-4,7,9,11H2,(H,16,17)(H,18,19) |
| InChIKey | ZKYLJIFDGKEQTE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|