C35H40O8 — CID 170234133
2-O-(4-benzoyloxy-2,3-dimethylbutan-2-yl) 1-O-(4-benzoyloxy-4-methylhexan-2-yl) benzene-1,2-dicarboxylate (PubChem CID 170234133) has the molecular formula C35H40O8 and a molecular weight of 588.70 g/mol. Its IUPAC name is 2-O-(4-benzoyloxy-2,3-dimethylbutan-2-yl) 1-O-(4-benzoyloxy-4-methylhexan-2-yl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(4-benzoyloxy-2,3-dimethylbutan-2-yl) 1-O-(4-benzoyloxy-4-methylhexan-2-yl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170234133 |
| Molecular Formula | C35H40O8 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 2-O-(4-benzoyloxy-2,3-dimethylbutan-2-yl) 1-O-(4-benzoyloxy-4-methylhexan-2-yl) benzene-1,2-dicarboxylate |
| SMILES | CCC(C)(CC(C)OC(=O)c1ccccc1C(=O)OC(C)(C)C(C)COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H40O8/c1-7-35(6,43-31(37)27-18-12-9-13-19-27)22-25(3)41-32(38)28-20-14-15-21-29(28)33(39)42-34(4,5)24(2)23-40-30(36)26-16-10-8-11-17-26/h8-21,24-25H,7,22-23H2,1-6H3 |
| InChIKey | VBEWFAZTSSDKAL-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|