C28H27ClFN3O6 — CID 170234790
N-[(10S,23R)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-propoxyacetamide (PubChem CID 170234790) has the molecular formula C28H27ClFN3O6 and a molecular weight of 555.99 g/mol. Its IUPAC name is N-[(10S,23R)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-propoxyacetamide.
| Compound Name | N-[(10S,23R)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-propoxyacetamide |
|---|---|
| PubChem CID | 170234790 |
| Molecular Formula | C28H27ClFN3O6 |
| Molecular Weight | 555.99 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | N-[(10S,23R)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-propoxyacetamide |
| SMILES | CCCOCC(=O)N[C@@H]1CCc2c(Cl)c(F)cc3nc4c(c1c23)Cn1c-4cc2c(c1=O)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C28H27ClFN3O6/c1-3-7-38-12-21(34)31-18-6-5-13-22-19(9-17(30)24(13)29)32-25-14(23(18)22)10-33-20(25)8-16-15(26(33)35)11-39-27(36)28(16,37)4-2/h8-9,18,37H,3-7,10-12H2,1-2H3,(H,31,34)/t18-,28+/m1/s1 |
| InChIKey | XYPVWBOHJNEYOD-WRHNGFHOSA-N |
| XLogP | 3.40 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.99 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|