C27H23ClFN3O6 — CID 171574513
N-[(10S)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-hydroxybut-3-enamide (PubChem CID 171574513) has the molecular formula C27H23ClFN3O6 and a molecular weight of 539.95 g/mol. Its IUPAC name is N-[(10S)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-hydroxybut-3-enamide.
| Compound Name | N-[(10S)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-hydroxybut-3-enamide |
|---|---|
| PubChem CID | 171574513 |
| Molecular Formula | C27H23ClFN3O6 |
| Molecular Weight | 539.95 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-[(10S)-19-chloro-10-ethyl-18-fluoro-10-hydroxy-5,9-dioxo-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaen-23-yl]-2-hydroxybut-3-enamide |
| SMILES | C=CC(O)C(=O)NC1CCc2c(Cl)c(F)cc3nc4c(c1c23)Cn1c-4cc2c(c1=O)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C27H23ClFN3O6/c1-3-19(33)24(34)31-16-6-5-11-20-17(8-15(29)22(11)28)30-23-12(21(16)20)9-32-18(23)7-14-13(25(32)35)10-38-26(36)27(14,37)4-2/h3,7-8,16,19,33,37H,1,4-6,9-10H2,2H3,(H,31,34)/t16?,19?,27-/m0/s1 |
| InChIKey | ARQMCXXPTORLHB-AJZKQVEVSA-N |
| XLogP | 2.52 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.95 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|