2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid

C10H9F2IO3 — CID 170235329

IUPAC2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid
SMILESO=C(O)C(F)(F)COCc1ccc(I)cc1
InChIInChI=1S/C10H9F2IO3/c11-10(12,9(14)15)6-16-5-7-1-3-8(13)4-2-7/h1-4H,5-6H2,(H,14,15)
InChIKeyGWMDPTOOCFUEEK-UHFFFAOYSA-N
MW342.08 g/mol
LogP2.53
Rot. Bonds5

About 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid

2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid (PubChem CID 170235329) has the molecular formula C10H9F2IO3 and a molecular weight of 342.08 g/mol. Its IUPAC name is 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid.

Molecular Properties

Compound Name2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid
PubChem CID170235329
Molecular FormulaC10H9F2IO3
Molecular Weight342.08 g/mol
Exact Mass341.96
IUPAC Name2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid
SMILESO=C(O)C(F)(F)COCc1ccc(I)cc1
InChIInChI=1S/C10H9F2IO3/c11-10(12,9(14)15)6-16-5-7-1-3-8(13)4-2-7/h1-4H,5-6H2,(H,14,15)
InChIKeyGWMDPTOOCFUEEK-UHFFFAOYSA-N
XLogP2.53
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.08
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid?
The IUPAC name of 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid (CID 170235329) is 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid.
What is the SMILES notation for 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid?
The canonical SMILES for 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid is O=C(O)C(F)(F)COCc1ccc(I)cc1.
What is the InChIKey of 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid?
The InChIKey is GWMDPTOOCFUEEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2IO3/c11-10(12,9(14)15)6-16-5-7-1-3-8(13)4-2-7/h1-4H,5-6H2,(H,14,15).
What are the key properties of 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid?
2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid has a molecular weight of 342.08 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid is sourced from PubChem (CID 170235329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).