C10H9F2IO3 — CID 170235329
2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid (PubChem CID 170235329) has the molecular formula C10H9F2IO3 and a molecular weight of 342.08 g/mol. Its IUPAC name is 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid.
| Compound Name | 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 170235329 |
| Molecular Formula | C10H9F2IO3 |
| Molecular Weight | 342.08 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 2,2-difluoro-3-[(4-iodophenyl)methoxy]propanoic acid |
| SMILES | O=C(O)C(F)(F)COCc1ccc(I)cc1 |
| InChI | InChI=1S/C10H9F2IO3/c11-10(12,9(14)15)6-16-5-7-1-3-8(13)4-2-7/h1-4H,5-6H2,(H,14,15) |
| InChIKey | GWMDPTOOCFUEEK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.08 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|