C15H24F2N3O2+ — CID 170236298
tert-butyl 4,4-difluoro-1-methyl-3-(1-methylpyrazol-4-yl)piperidin-1-ium-1-carboxylate (PubChem CID 170236298) has the molecular formula C15H24F2N3O2+ and a molecular weight of 316.37 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-1-methyl-3-(1-methylpyrazol-4-yl)piperidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 4,4-difluoro-1-methyl-3-(1-methylpyrazol-4-yl)piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 170236298 |
| Molecular Formula | C15H24F2N3O2+ |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 4,4-difluoro-1-methyl-3-(1-methylpyrazol-4-yl)piperidin-1-ium-1-carboxylate |
| SMILES | Cn1cc(C2C[N+](C)(C(=O)OC(C)(C)C)CCC2(F)F)cn1 |
| InChI | InChI=1S/C15H24F2N3O2/c1-14(2,3)22-13(21)20(5)7-6-15(16,17)12(10-20)11-8-18-19(4)9-11/h8-9,12H,6-7,10H2,1-5H3/q+1 |
| InChIKey | GDIWRFLCOCVCLE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|