C14H22N2O2 — CID 135342786
tert-butyl 2-ethyl-3-(1-methylpyrazol-4-yl)cyclopropane-1-carboxylate (PubChem CID 135342786) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is tert-butyl 2-ethyl-3-(1-methylpyrazol-4-yl)cyclopropane-1-carboxylate.
| Compound Name | tert-butyl 2-ethyl-3-(1-methylpyrazol-4-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 135342786 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | tert-butyl 2-ethyl-3-(1-methylpyrazol-4-yl)cyclopropane-1-carboxylate |
| SMILES | CCC1C(C(=O)OC(C)(C)C)C1c1cnn(C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-6-10-11(9-7-15-16(5)8-9)12(10)13(17)18-14(2,3)4/h7-8,10-12H,6H2,1-5H3 |
| InChIKey | IIWRNYMGCZXRFF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |