C28H40N8 — CID 170238163
N-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]-6-methyl-2-[4-[(3-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]pyrimidin-4-amine (PubChem CID 170238163) has the molecular formula C28H40N8 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]-6-methyl-2-[4-[(3-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]pyrimidin-4-amine.
| Compound Name | N-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]-6-methyl-2-[4-[(3-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170238163 |
| Molecular Formula | C28H40N8 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | N-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]-6-methyl-2-[4-[(3-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]pyrimidin-4-amine |
| SMILES | C#CCCC1(CCNc2cc(C)nc(N3CCC(NCc4cccc(N5CCCC5)c4)CC3)n2)NN1 |
| InChI | InChI=1S/C28H40N8/c1-3-4-12-28(33-34-28)13-14-29-26-19-22(2)31-27(32-26)36-17-10-24(11-18-36)30-21-23-8-7-9-25(20-23)35-15-5-6-16-35/h1,7-9,19-20,24,30,33-34H,4-6,10-18,21H2,2H3,(H,29,31,32) |
| InChIKey | LJBKCCPCPUGEPX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|