About 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone
1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone (PubChem CID 170239051) has the molecular formula C7H6F5NOS
and a molecular weight of 247.19 g/mol. Its IUPAC name is 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone |
| PubChem CID | 170239051 |
| Molecular Formula | C7H6F5NOS |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone |
| SMILES | CC(=O)c1cccc(S(F)(F)(F)(F)F)n1 |
| InChI | InChI=1S/C7H6F5NOS/c1-5(14)6-3-2-4-7(13-6)15(8,9,10,11)12/h2-4H,1H3 |
| InChIKey | PTNWNAAVQCOQSX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone?
The IUPAC name of 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone (CID 170239051) is 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone.
What is the SMILES notation for 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone?
The canonical SMILES for 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone is CC(=O)c1cccc(S(F)(F)(F)(F)F)n1.
What is the InChIKey of 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone?
The InChIKey is PTNWNAAVQCOQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F5NOS/c1-5(14)6-3-2-4-7(13-6)15(8,9,10,11)12/h2-4H,1H3.
What are the key properties of 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone?
1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone has a molecular weight of 247.19 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(pentafluoro-λ6-sulfanyl)-2-pyridinyl]ethanone is sourced from PubChem (CID 170239051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).