C13H23NS — CID 170239107
2-(3,3-dimethylbutyl)-5-(2-methylpropyl)-1,3-thiazole (PubChem CID 170239107) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-5-(2-methylpropyl)-1,3-thiazole.
| Compound Name | 2-(3,3-dimethylbutyl)-5-(2-methylpropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 170239107 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-5-(2-methylpropyl)-1,3-thiazole |
| SMILES | CC(C)Cc1cnc(CCC(C)(C)C)s1 |
| InChI | InChI=1S/C13H23NS/c1-10(2)8-11-9-14-12(15-11)6-7-13(3,4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | MTLQQDSTBYXQQC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |