C17H15ClN8O2S — CID 17024330
N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 17024330) has the molecular formula C17H15ClN8O2S and a molecular weight of 430.88 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 17024330 |
| Molecular Formula | C17H15ClN8O2S |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-[(3-methyl-4-nitropyrazol-1-yl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nn(Cc2nnc(Nc3ccn(Cc4ccccc4Cl)n3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15ClN8O2S/c1-11-14(26(27)28)9-25(22-11)10-16-20-21-17(29-16)19-15-6-7-24(23-15)8-12-4-2-3-5-13(12)18/h2-7,9H,8,10H2,1H3,(H,19,21,23) |
| InChIKey | OMGGAYSQWWWZPV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|