C19H20ClFN8O6S2 — CID 90483055
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine;sulfuric acid (PubChem CID 90483055) has the molecular formula C19H20ClFN8O6S2 and a molecular weight of 575.00 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine;sulfuric acid.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 90483055 |
| Molecular Formula | C19H20ClFN8O6S2 |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,3,4-thiadiazol-2-amine;sulfuric acid |
| SMILES | Cc1nn(CCc2nnc(Nc3ccn(Cc4c(F)cccc4Cl)n3)s2)c(C)c1[N+](=O)[O-].O=S(=O)(O)O |
| InChI | InChI=1S/C19H18ClFN8O2S.H2O4S/c1-11-18(29(30)31)12(2)28(25-11)9-7-17-23-24-19(32-17)22-16-6-8-27(26-16)10-13-14(20)4-3-5-15(13)21;1-5(2,3)4/h3-6,8H,7,9-10H2,1-2H3,(H,22,24,26);(H2,1,2,3,4) |
| InChIKey | XUNZEJLPEUMOOD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|