C20H20ClFN8O2S — CID 51388487
N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2S)-1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 51388487) has the molecular formula C20H20ClFN8O2S and a molecular weight of 490.95 g/mol. Its IUPAC name is N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2S)-1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2S)-1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 51388487 |
| Molecular Formula | C20H20ClFN8O2S |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-5-[(2S)-1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nn(C[C@H](C)c2nnc(Nc3ccn(Cc4c(F)cccc4Cl)n3)s2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20ClFN8O2S/c1-11(9-29-13(3)18(30(31)32)12(2)26-29)19-24-25-20(33-19)23-17-7-8-28(27-17)10-14-15(21)5-4-6-16(14)22/h4-8,11H,9-10H2,1-3H3,(H,23,25,27)/t11-/m0/s1 |
| InChIKey | FYMJULBYTRWOBK-NSHDSACASA-N |
| XLogP | 4.84 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|