C37H47N3O3 — CID 170243944
3-(2-cyclopropylmorpholin-4-yl)-1-[4-(4-heptoxyphenyl)anilino]-6-propan-2-yl-6,7-dihydrocyclopenta[c]pyridin-5-one (PubChem CID 170243944) has the molecular formula C37H47N3O3 and a molecular weight of 581.80 g/mol. Its IUPAC name is 3-(2-cyclopropylmorpholin-4-yl)-1-[4-(4-heptoxyphenyl)anilino]-6-propan-2-yl-6,7-dihydrocyclopenta[c]pyridin-5-one.
| Compound Name | 3-(2-cyclopropylmorpholin-4-yl)-1-[4-(4-heptoxyphenyl)anilino]-6-propan-2-yl-6,7-dihydrocyclopenta[c]pyridin-5-one |
|---|---|
| PubChem CID | 170243944 |
| Molecular Formula | C37H47N3O3 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | 3-(2-cyclopropylmorpholin-4-yl)-1-[4-(4-heptoxyphenyl)anilino]-6-propan-2-yl-6,7-dihydrocyclopenta[c]pyridin-5-one |
| SMILES | CCCCCCCOc1ccc(-c2ccc(Nc3nc(N4CCOC(C5CC5)C4)cc4c3CC(C(C)C)C4=O)cc2)cc1 |
| InChI | InChI=1S/C37H47N3O3/c1-4-5-6-7-8-20-42-30-17-13-27(14-18-30)26-11-15-29(16-12-26)38-37-33-22-31(25(2)3)36(41)32(33)23-35(39-37)40-19-21-43-34(24-40)28-9-10-28/h11-18,23,25,28,31,34H,4-10,19-22,24H2,1-3H3,(H,38,39) |
| InChIKey | CKPJIKDKEKZAIW-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|