C15H22N2O3 — CID 170248295
N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide (PubChem CID 170248295) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide.
| Compound Name | N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 170248295 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide |
| SMILES | O=C(NC[C@H](O)CO)C1CC(c2ccccc2)CCN1 |
| InChI | InChI=1S/C15H22N2O3/c18-10-13(19)9-17-15(20)14-8-12(6-7-16-14)11-4-2-1-3-5-11/h1-5,12-14,16,18-19H,6-10H2,(H,17,20)/t12?,13-,14?/m0/s1 |
| InChIKey | OQMSTMCQUFBTSL-MOKVOYLWSA-N |
| XLogP | -0.01 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |