About N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide
N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide (PubChem CID 170248295) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide |
| PubChem CID | 170248295 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide |
| SMILES | O=C(NC[C@H](O)CO)C1CC(c2ccccc2)CCN1 |
| InChI | InChI=1S/C15H22N2O3/c18-10-13(19)9-17-15(20)14-8-12(6-7-16-14)11-4-2-1-3-5-11/h1-5,12-14,16,18-19H,6-10H2,(H,17,20)/t12?,13-,14?/m0/s1 |
| InChIKey | OQMSTMCQUFBTSL-MOKVOYLWSA-N |
| XLogP | -0.01 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide?
The IUPAC name of N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide (CID 170248295) is N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide.
What is the SMILES notation for N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide?
The canonical SMILES for N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide is O=C(NC[C@H](O)CO)C1CC(c2ccccc2)CCN1.
What is the InChIKey of N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide?
The InChIKey is OQMSTMCQUFBTSL-MOKVOYLWSA-N. The full InChI is InChI=1S/C15H22N2O3/c18-10-13(19)9-17-15(20)14-8-12(6-7-16-14)11-4-2-1-3-5-11/h1-5,12-14,16,18-19H,6-10H2,(H,17,20)/t12?,13-,14?/m0/s1.
What are the key properties of N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide?
N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide has a molecular weight of 278.35 g/mol, XLogP of -0.01, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2,3-dihydroxypropyl]-4-phenylpiperidine-2-carboxamide is sourced from PubChem (CID 170248295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).