C21H26N2O3 — CID 140659220
N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-4-phenylpiperidine-2-carboxamide (PubChem CID 140659220) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-4-phenylpiperidine-2-carboxamide.
| Compound Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-4-phenylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 140659220 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-4-phenylpiperidine-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)[C@@H](O)c1ccccc1)C1CC(c2ccccc2)CCN1 |
| InChI | InChI=1S/C21H26N2O3/c24-14-19(20(25)16-9-5-2-6-10-16)23-21(26)18-13-17(11-12-22-18)15-7-3-1-4-8-15/h1-10,17-20,22,24-25H,11-14H2,(H,23,26)/t17?,18?,19-,20-/m0/s1 |
| InChIKey | XAEYQKUYASOJLC-GUMHCPJTSA-N |
| XLogP | 1.73 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |