C25H28N8O2 — CID 170248908
4-[[4-(1H-indazol-6-ylamino)-5-methylpyrimidin-2-yl]amino]-N-[(oxan-4-ylamino)methyl]benzamide (PubChem CID 170248908) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[4-(1H-indazol-6-ylamino)-5-methylpyrimidin-2-yl]amino]-N-[(oxan-4-ylamino)methyl]benzamide.
| Compound Name | 4-[[4-(1H-indazol-6-ylamino)-5-methylpyrimidin-2-yl]amino]-N-[(oxan-4-ylamino)methyl]benzamide |
|---|---|
| PubChem CID | 170248908 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 4-[[4-(1H-indazol-6-ylamino)-5-methylpyrimidin-2-yl]amino]-N-[(oxan-4-ylamino)methyl]benzamide |
| SMILES | Cc1cnc(Nc2ccc(C(=O)NCNC3CCOCC3)cc2)nc1Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C25H28N8O2/c1-16-13-26-25(32-23(16)30-21-7-4-18-14-29-33-22(18)12-21)31-20-5-2-17(3-6-20)24(34)28-15-27-19-8-10-35-11-9-19/h2-7,12-14,19,27H,8-11,15H2,1H3,(H,28,34)(H,29,33)(H2,26,30,31,32) |
| InChIKey | FCXBCBKHYCKNPY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|