C31H43NO — CID 170250831
3-[(4R)-4-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzonitrile (PubChem CID 170250831) has the molecular formula C31H43NO and a molecular weight of 445.69 g/mol. Its IUPAC name is 3-[(4R)-4-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzonitrile.
| Compound Name | 3-[(4R)-4-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzonitrile |
|---|---|
| PubChem CID | 170250831 |
| Molecular Formula | C31H43NO |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | 3-[(4R)-4-[(17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]benzonitrile |
| SMILES | C[C@H](CCCc1cccc(C#N)c1)[C@H]1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C31H43NO/c1-21(6-4-7-22-8-5-9-23(18-22)20-32)27-12-13-28-26-11-10-24-19-25(33)14-16-30(24,2)29(26)15-17-31(27,28)3/h5,8-10,18,21,25-29,33H,4,6-7,11-17,19H2,1-3H3/t21-,25?,26?,27-,28?,29?,30?,31?/m1/s1 |
| InChIKey | JDVAGIFYTFIUAM-RWNFWEMWSA-N |
| XLogP | 7.46 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|