C31H43NO2 — CID 170607086
3-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzonitrile (PubChem CID 170607086) has the molecular formula C31H43NO2 and a molecular weight of 461.69 g/mol. Its IUPAC name is 3-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzonitrile.
| Compound Name | 3-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzonitrile |
|---|---|
| PubChem CID | 170607086 |
| Molecular Formula | C31H43NO2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | 3-[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzonitrile |
| SMILES | C[C@H](CCCOc1cccc(C#N)c1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H43NO2/c1-21(6-5-17-34-25-8-4-7-22(18-25)20-32)27-11-12-28-26-10-9-23-19-24(33)13-15-30(23,2)29(26)14-16-31(27,28)3/h4,7-9,18,21,24,26-29,33H,5-6,10-17,19H2,1-3H3/t21-,24+,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | LICMUFBOZLACGH-CIMDZAPNSA-N |
| XLogP | 7.29 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|