C31H44O4 — CID 170607085
3-[(4R)-4-[(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzoic acid (PubChem CID 170607085) has the molecular formula C31H44O4 and a molecular weight of 480.69 g/mol. Its IUPAC name is 3-[(4R)-4-[(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzoic acid.
| Compound Name | 3-[(4R)-4-[(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzoic acid |
|---|---|
| PubChem CID | 170607085 |
| Molecular Formula | C31H44O4 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 3-[(4R)-4-[(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentoxy]benzoic acid |
| SMILES | C[C@H](CCCOc1cccc(C(=O)O)c1)[C@H]1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C31H44O4/c1-20(6-5-17-35-24-8-4-7-21(18-24)29(33)34)26-11-12-27-25-10-9-22-19-23(32)13-15-30(22,2)28(25)14-16-31(26,27)3/h4,7-9,18,20,23,25-28,32H,5-6,10-17,19H2,1-3H3,(H,33,34)/t20-,23+,25?,26-,27?,28?,30+,31-/m1/s1 |
| InChIKey | PQORSWZLKRZLRP-JILWCQEXSA-N |
| XLogP | 7.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|