C14H19ClN2 — CID 170250864
7-(2-chloro-4-methylphenyl)-2,7-diazaspiro[3.5]nonane (PubChem CID 170250864) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 7-(2-chloro-4-methylphenyl)-2,7-diazaspiro[3.5]nonane.
| Compound Name | 7-(2-chloro-4-methylphenyl)-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 170250864 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 7-(2-chloro-4-methylphenyl)-2,7-diazaspiro[3.5]nonane |
| SMILES | Cc1ccc(N2CCC3(CC2)CNC3)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2/c1-11-2-3-13(12(15)8-11)17-6-4-14(5-7-17)9-16-10-14/h2-3,8,16H,4-7,9-10H2,1H3 |
| InChIKey | QYEMVFCHMKBFGI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |