C14H20ClNO2 — CID 19957775
1-(2-chloro-4-methylphenyl)-4,4-dimethoxypiperidine (PubChem CID 19957775) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-4,4-dimethoxypiperidine.
| Compound Name | 1-(2-chloro-4-methylphenyl)-4,4-dimethoxypiperidine |
|---|---|
| PubChem CID | 19957775 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-4,4-dimethoxypiperidine |
| SMILES | COC1(OC)CCN(c2ccc(C)cc2Cl)CC1 |
| InChI | InChI=1S/C14H20ClNO2/c1-11-4-5-13(12(15)10-11)16-8-6-14(17-2,18-3)7-9-16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | WACJYEOLFOIQEK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|