C27H27FN4S — CID 17025195
1,1-dibenzyl-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 17025195) has the molecular formula C27H27FN4S and a molecular weight of 458.61 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1,1-dibenzyl-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 17025195 |
| Molecular Formula | C27H27FN4S |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1,1-dibenzyl-3-[1-[(2-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2F)c(C)c1NC(=S)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H27FN4S/c1-20-26(21(2)32(30-20)19-24-15-9-10-16-25(24)28)29-27(33)31(17-22-11-5-3-6-12-22)18-23-13-7-4-8-14-23/h3-16H,17-19H2,1-2H3,(H,29,33) |
| InChIKey | VQOWMUXENSXZJK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|