C30H28N2O6 — CID 170252533
(2R)-2-[[(2S)-2-[[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 170252533) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 170252533 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H28N2O6/c33-28(14-8-7-13-23-15-16-26-27(19-23)38-20-37-26)31-24(17-21-9-3-1-4-10-21)29(34)32-25(30(35)36)18-22-11-5-2-6-12-22/h1-16,19,24-25H,17-18,20H2,(H,31,33)(H,32,34)(H,35,36)/b13-7+,14-8+/t24-,25+/m0/s1 |
| InChIKey | JYWOVQDTNCWESE-PZHKOSEXSA-N |
| XLogP | 3.52 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|