C28H32F4N4O3 — CID 170255158
[4-[3-[4-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxyphenyl]methanediol (PubChem CID 170255158) has the molecular formula C28H32F4N4O3 and a molecular weight of 548.58 g/mol. Its IUPAC name is [4-[3-[4-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxyphenyl]methanediol.
| Compound Name | [4-[3-[4-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxyphenyl]methanediol |
|---|---|
| PubChem CID | 170255158 |
| Molecular Formula | C28H32F4N4O3 |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [4-[3-[4-[[(3R,4S)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxyphenyl]methanediol |
| SMILES | CCN1CC[C@H](Nc2cccc3c2cc(C#CCNc2ccc(C(O)O)cc2OC)n3CC(F)(F)F)[C@H](F)C1 |
| InChI | InChI=1S/C28H32F4N4O3/c1-3-35-13-11-23(21(29)16-35)34-22-7-4-8-25-20(22)15-19(36(25)17-28(30,31)32)6-5-12-33-24-10-9-18(27(37)38)14-26(24)39-2/h4,7-10,14-15,21,23,27,33-34,37-38H,3,11-13,16-17H2,1-2H3/t21-,23+/m1/s1 |
| InChIKey | BKRMPSREQJITTJ-GGAORHGYSA-N |
| XLogP | 4.50 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|