C30H38FN7O2 — CID 170255757
(2E,4E)-2-fluoro-4-[6-[3-methyl-4-(1-methylpiperidin-4-yl)anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-5-[methyl(propan-2-yl)amino]penta-2,4-dienal (PubChem CID 170255757) has the molecular formula C30H38FN7O2 and a molecular weight of 547.68 g/mol. Its IUPAC name is (2E,4E)-2-fluoro-4-[6-[3-methyl-4-(1-methylpiperidin-4-yl)anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-5-[methyl(propan-2-yl)amino]penta-2,4-dienal.
| Compound Name | (2E,4E)-2-fluoro-4-[6-[3-methyl-4-(1-methylpiperidin-4-yl)anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-5-[methyl(propan-2-yl)amino]penta-2,4-dienal |
|---|---|
| PubChem CID | 170255757 |
| Molecular Formula | C30H38FN7O2 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | (2E,4E)-2-fluoro-4-[6-[3-methyl-4-(1-methylpiperidin-4-yl)anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-5-[methyl(propan-2-yl)amino]penta-2,4-dienal |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(C4CCN(C)CC4)c(C)c3)nc2n1C(/C=C(/F)C=O)=C/N(C)C(C)C |
| InChI | InChI=1S/C30H38FN7O2/c1-7-12-37-29(40)27-17-32-30(33-24-8-9-26(21(4)15-24)22-10-13-35(5)14-11-22)34-28(27)38(37)25(16-23(31)19-39)18-36(6)20(2)3/h7-9,15-20,22H,1,10-14H2,2-6H3,(H,32,33,34)/b23-16+,25-18+ |
| InChIKey | MUVNYNZYAYVKKM-OMFXKEETSA-N |
| XLogP | 4.83 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|