C29H39N9O2 — CID 170251397
(Z,4E)-4-[6-[3-methyl-4-[4-(methylamino)piperidin-1-yl]anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-[methyl(propan-2-yl)hydrazinylidene]but-2-enal (PubChem CID 170251397) has the molecular formula C29H39N9O2 and a molecular weight of 545.69 g/mol. Its IUPAC name is (Z,4E)-4-[6-[3-methyl-4-[4-(methylamino)piperidin-1-yl]anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-[methyl(propan-2-yl)hydrazinylidene]but-2-enal.
| Compound Name | (Z,4E)-4-[6-[3-methyl-4-[4-(methylamino)piperidin-1-yl]anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-[methyl(propan-2-yl)hydrazinylidene]but-2-enal |
|---|---|
| PubChem CID | 170251397 |
| Molecular Formula | C29H39N9O2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | (Z,4E)-4-[6-[3-methyl-4-[4-(methylamino)piperidin-1-yl]anilino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]-4-[methyl(propan-2-yl)hydrazinylidene]but-2-enal |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCC(NC)CC4)c(C)c3)nc2n1C(/C=C\C=O)=N/N(C)C(C)C |
| InChI | InChI=1S/C29H39N9O2/c1-7-14-37-28(40)24-19-31-29(33-27(24)38(37)26(9-8-17-39)34-35(6)20(2)3)32-23-10-11-25(21(4)18-23)36-15-12-22(30-5)13-16-36/h7-11,17-20,22,30H,1,12-16H2,2-6H3,(H,31,32,33)/b9-8-,34-26+ |
| InChIKey | ZXMIOMFJBWVQEC-JVAUNWEMSA-N |
| XLogP | 3.28 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|