C29H39N9O2 — CID 170252636
N-[(E)-[(Z)-1-[3-oxo-2-prop-2-enyl-6-[4-(3,4,5-trimethylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide (PubChem CID 170252636) has the molecular formula C29H39N9O2 and a molecular weight of 545.69 g/mol. Its IUPAC name is N-[(E)-[(Z)-1-[3-oxo-2-prop-2-enyl-6-[4-(3,4,5-trimethylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide.
| Compound Name | N-[(E)-[(Z)-1-[3-oxo-2-prop-2-enyl-6-[4-(3,4,5-trimethylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 170252636 |
| Molecular Formula | C29H39N9O2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | N-[(E)-[(Z)-1-[3-oxo-2-prop-2-enyl-6-[4-(3,4,5-trimethylpiperazin-1-yl)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CC(C)N(C)C(C)C4)cc3)nc2n1C(/C=C\C)=N/N(C=O)C(C)C |
| InChI | InChI=1S/C29H39N9O2/c1-8-10-26(33-36(19-39)20(3)4)38-27-25(28(40)37(38)15-9-2)16-30-29(32-27)31-23-11-13-24(14-12-23)35-17-21(5)34(7)22(6)18-35/h8-14,16,19-22H,2,15,17-18H2,1,3-7H3,(H,30,31,32)/b10-8-,33-26+ |
| InChIKey | AGIXYPOXYHWJRG-CRKYXZCASA-N |
| XLogP | 3.66 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|