C30H40N8O2 — CID 170253079
N-[(E)-[(Z)-1-[6-[(4,4-dimethyl-2-propan-2-yl-1,3-dihydroisoquinolin-6-yl)amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide (PubChem CID 170253079) has the molecular formula C30H40N8O2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[(E)-[(Z)-1-[6-[(4,4-dimethyl-2-propan-2-yl-1,3-dihydroisoquinolin-6-yl)amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide.
| Compound Name | N-[(E)-[(Z)-1-[6-[(4,4-dimethyl-2-propan-2-yl-1,3-dihydroisoquinolin-6-yl)amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 170253079 |
| Molecular Formula | C30H40N8O2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | N-[(E)-[(Z)-1-[6-[(4,4-dimethyl-2-propan-2-yl-1,3-dihydroisoquinolin-6-yl)amino]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enylidene]amino]-N-propan-2-ylformamide |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)C(C)(C)CN(C(C)C)C4)nc2n1C(/C=C\C)=N/N(C=O)C(C)C |
| InChI | InChI=1S/C30H40N8O2/c1-9-11-26(34-36(19-39)21(5)6)38-27-24(28(40)37(38)14-10-2)16-31-29(33-27)32-23-13-12-22-17-35(20(3)4)18-30(7,8)25(22)15-23/h9-13,15-16,19-21H,2,14,17-18H2,1,3-8H3,(H,31,32,33)/b11-9-,34-26+ |
| InChIKey | UJEJGKOOUXYWHT-OYEITTFUSA-N |
| XLogP | 4.63 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|