C29H41N9O2 — CID 170253304
(Z,4E)-4-[tert-butyl(methyl)hydrazinylidene]-4-[6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-3-oxo-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enal (PubChem CID 170253304) has the molecular formula C29H41N9O2 and a molecular weight of 547.71 g/mol. Its IUPAC name is (Z,4E)-4-[tert-butyl(methyl)hydrazinylidene]-4-[6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-3-oxo-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enal.
| Compound Name | (Z,4E)-4-[tert-butyl(methyl)hydrazinylidene]-4-[6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-3-oxo-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enal |
|---|---|
| PubChem CID | 170253304 |
| Molecular Formula | C29H41N9O2 |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | (Z,4E)-4-[tert-butyl(methyl)hydrazinylidene]-4-[6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-3-oxo-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-1-yl]but-2-enal |
| SMILES | Cc1cc(Nc2ncc3c(=O)n(C(C)C)n(C(/C=C\C=O)=N/N(C)C(C)(C)C)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C29H41N9O2/c1-20(2)37-27(40)23-19-30-28(31-22-11-12-24(21(3)18-22)36-15-13-34(7)14-16-36)32-26(23)38(37)25(10-9-17-39)33-35(8)29(4,5)6/h9-12,17-20H,13-16H2,1-8H3,(H,30,31,32)/b10-9-,33-25+ |
| InChIKey | CCTOKNVBIHJTAR-LINHNXMUSA-N |
| XLogP | 3.62 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|