C23H41N3 — CID 170256124
(4S,6R)-5-tert-butyl-12-(2-methylnonan-2-yl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene (PubChem CID 170256124) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is (4S,6R)-5-tert-butyl-12-(2-methylnonan-2-yl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene.
| Compound Name | (4S,6R)-5-tert-butyl-12-(2-methylnonan-2-yl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
|---|---|
| PubChem CID | 170256124 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | (4S,6R)-5-tert-butyl-12-(2-methylnonan-2-yl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
| SMILES | CCCCCCCC(C)(C)n1nnc2c1CC[C@@H]1C(C(C)(C)C)[C@@H]1CC2 |
| InChI | InChI=1S/C23H41N3/c1-7-8-9-10-11-16-23(5,6)26-20-15-13-18-17(21(18)22(2,3)4)12-14-19(20)24-25-26/h17-18,21H,7-16H2,1-6H3/t17-,18+,21?/m1/s1 |
| InChIKey | MIADUGULJZWJAB-IZKAZRHKSA-N |
| XLogP | 6.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|